C15H24O4 — CID 10635613
methyl (4E)-2-acetyl-5-(hydroxymethyl)-9-methyldeca-4,8-dienoate (PubChem CID 10635613) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is methyl (4E)-2-acetyl-5-(hydroxymethyl)-9-methyldeca-4,8-dienoate.
| Compound Name | methyl (4E)-2-acetyl-5-(hydroxymethyl)-9-methyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 10635613 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | methyl (4E)-2-acetyl-5-(hydroxymethyl)-9-methyldeca-4,8-dienoate |
| SMILES | COC(=O)C(C/C=C(/CO)CCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C15H24O4/c1-11(2)6-5-7-13(10-16)8-9-14(12(3)17)15(18)19-4/h6,8,14,16H,5,7,9-10H2,1-4H3/b13-8+ |
| InChIKey | WBWXKDGSTHDONU-MDWZMJQESA-N |
| XLogP | 2.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|