C16H26O — CID 139299568
(2E,6E)-3,6,8,11-tetramethyldodeca-2,6,10-trienal (PubChem CID 139299568) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (2E,6E)-3,6,8,11-tetramethyldodeca-2,6,10-trienal.
| Compound Name | (2E,6E)-3,6,8,11-tetramethyldodeca-2,6,10-trienal |
|---|---|
| PubChem CID | 139299568 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (2E,6E)-3,6,8,11-tetramethyldodeca-2,6,10-trienal |
| SMILES | CC(C)=CCC(C)/C=C(\C)CC/C(C)=C/C=O |
| InChI | InChI=1S/C16H26O/c1-13(2)6-7-15(4)12-16(5)9-8-14(3)10-11-17/h6,10-12,15H,7-9H2,1-5H3/b14-10+,16-12+ |
| InChIKey | LQOWZJPSSOYMQH-FRPPMVQASA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|