C22H36I2O2 — CID 91156191
(2E,10E)-5-methoxy-3,7,9,11,15-pentamethylhexadeca-2,6,10,14-tetraenal;molecular iodine (PubChem CID 91156191) has the molecular formula C22H36I2O2 and a molecular weight of 586.34 g/mol. Its IUPAC name is (2E,10E)-5-methoxy-3,7,9,11,15-pentamethylhexadeca-2,6,10,14-tetraenal;molecular iodine.
| Compound Name | (2E,10E)-5-methoxy-3,7,9,11,15-pentamethylhexadeca-2,6,10,14-tetraenal;molecular iodine |
|---|---|
| PubChem CID | 91156191 |
| Molecular Formula | C22H36I2O2 |
| Molecular Weight | 586.34 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | (2E,10E)-5-methoxy-3,7,9,11,15-pentamethylhexadeca-2,6,10,14-tetraenal;molecular iodine |
| SMILES | COC(C=C(C)CC(C)/C=C(\C)CCC=C(C)C)C/C(C)=C/C=O.II |
| InChI | InChI=1S/C22H36O2.I2/c1-17(2)9-8-10-18(3)13-20(5)14-21(6)16-22(24-7)15-19(4)11-12-23;1-2/h9,11-13,16,20,22H,8,10,14-15H2,1-7H3;/b18-13+,19-11+,21-16?; |
| InChIKey | OWEYKOSDKQUOCK-PHGCANIDSA-N |
| XLogP | 7.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.34 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|