C17H32O7P2 — CID 121473263
phosphono 4,6,8,12-tetramethyltrideca-3,7,11-trien-2-yl hydrogen phosphate (PubChem CID 121473263) has the molecular formula C17H32O7P2 and a molecular weight of 410.38 g/mol. Its IUPAC name is phosphono 4,6,8,12-tetramethyltrideca-3,7,11-trien-2-yl hydrogen phosphate.
| Compound Name | phosphono 4,6,8,12-tetramethyltrideca-3,7,11-trien-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 121473263 |
| Molecular Formula | C17H32O7P2 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | phosphono 4,6,8,12-tetramethyltrideca-3,7,11-trien-2-yl hydrogen phosphate |
| SMILES | CC(C)=CCCC(C)=CC(C)CC(C)=CC(C)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C17H32O7P2/c1-13(2)8-7-9-14(3)10-15(4)11-16(5)12-17(6)23-26(21,22)24-25(18,19)20/h8,10,12,15,17H,7,9,11H2,1-6H3,(H,21,22)(H2,18,19,20) |
| InChIKey | AAMYSEUBJYSDBL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|