C25H48O — CID 176571098
(6E)-8-methoxy-2,6-dimethyldocosa-2,6-diene (PubChem CID 176571098) has the molecular formula C25H48O and a molecular weight of 364.66 g/mol. Its IUPAC name is (6E)-8-methoxy-2,6-dimethyldocosa-2,6-diene.
| Compound Name | (6E)-8-methoxy-2,6-dimethyldocosa-2,6-diene |
|---|---|
| PubChem CID | 176571098 |
| Molecular Formula | C25H48O |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.37 |
| IUPAC Name | (6E)-8-methoxy-2,6-dimethyldocosa-2,6-diene |
| SMILES | CCCCCCCCCCCCCCC(/C=C(\C)CCC=C(C)C)OC |
| InChI | InChI=1S/C25H48O/c1-6-7-8-9-10-11-12-13-14-15-16-17-21-25(26-5)22-24(4)20-18-19-23(2)3/h19,22,25H,6-18,20-21H2,1-5H3/b24-22+ |
| InChIKey | PZGXHNSIWHODEL-ZNTNEXAZSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|