C29H52O2 — CID 6437124
(2E)-1-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]nonoxy]-3,7-dimethylocta-2,6-diene (PubChem CID 6437124) has the molecular formula C29H52O2 and a molecular weight of 432.73 g/mol. Its IUPAC name is (2E)-1-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]nonoxy]-3,7-dimethylocta-2,6-diene.
| Compound Name | (2E)-1-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]nonoxy]-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 6437124 |
| Molecular Formula | C29H52O2 |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 432.40 |
| IUPAC Name | (2E)-1-[1-[(2E)-3,7-dimethylocta-2,6-dienoxy]nonoxy]-3,7-dimethylocta-2,6-diene |
| SMILES | CCCCCCCCC(OC/C=C(\C)CCC=C(C)C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H52O2/c1-8-9-10-11-12-13-20-29(30-23-21-27(6)18-14-16-25(2)3)31-24-22-28(7)19-15-17-26(4)5/h16-17,21-22,29H,8-15,18-20,23-24H2,1-7H3/b27-21+,28-22+ |
| InChIKey | FOZNRVHWZWWCPV-GPAWKIAZSA-N |
| XLogP | 9.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|