C45H85NO5S — CID 176937235
2-[6-[dimethyl-[(9Z,12Z)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]octadeca-9,12-dienoxy]-λ4-sulfanyl]oxyhexyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 176937235) has the molecular formula C45H85NO5S and a molecular weight of 752.24 g/mol. Its IUPAC name is 2-[6-[dimethyl-[(9Z,12Z)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]octadeca-9,12-dienoxy]-λ4-sulfanyl]oxyhexyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[6-[dimethyl-[(9Z,12Z)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]octadeca-9,12-dienoxy]-λ4-sulfanyl]oxyhexyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 176937235 |
| Molecular Formula | C45H85NO5S |
| Molecular Weight | 752.24 g/mol |
| Exact Mass | 751.61 |
| IUPAC Name | 2-[6-[dimethyl-[(9Z,12Z)-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]octadeca-9,12-dienoxy]-λ4-sulfanyl]oxyhexyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(OC/C=C(\C)CC/C=C(\C)CCC=C(C)C)OS(C)(C)OCCCCCCN(CCO)CCO |
| InChI | InChI=1S/C45H85NO5S/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-33-45(49-41-34-44(5)32-28-31-43(4)30-27-29-42(2)3)51-52(6,7)50-40-26-23-22-25-35-46(36-38-47)37-39-48/h12-13,15-16,29,31,34,45,47-48H,8-11,14,17-28,30,32-33,35-41H2,1-7H3/b13-12-,16-15-,43-31+,44-34+ |
| InChIKey | YPOPBASAFFDKLK-RRBSNQEVSA-N |
| XLogP | 12.34 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.24 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|