C48H91NO3Si — CID 170742937
4-[6-[1-[dimethyl(octyl)silyl]oxyoctoxy]hexyl-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol (PubChem CID 170742937) has the molecular formula C48H91NO3Si and a molecular weight of 758.35 g/mol. Its IUPAC name is 4-[6-[1-[dimethyl(octyl)silyl]oxyoctoxy]hexyl-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol.
| Compound Name | 4-[6-[1-[dimethyl(octyl)silyl]oxyoctoxy]hexyl-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 170742937 |
| Molecular Formula | C48H91NO3Si |
| Molecular Weight | 758.35 g/mol |
| Exact Mass | 757.68 |
| IUPAC Name | 4-[6-[1-[dimethyl(octyl)silyl]oxyoctoxy]hexyl-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCN(CCCCO)CCCCCCOC(CCCCCCC)O[Si](C)(C)CCCCCCCC |
| InChI | InChI=1S/C48H91NO3Si/c1-6-9-12-15-17-18-19-20-21-22-23-24-25-26-27-28-30-35-42-49(44-37-38-45-50)43-36-31-32-39-46-51-48(41-34-29-14-11-8-3)52-53(4,5)47-40-33-16-13-10-7-2/h9,12,17-18,20-21,23-24,26-27,48,50H,6-8,10-11,13-16,19,22,25,28-47H2,1-5H3/b12-9-,18-17-,21-20-,24-23-,27-26- |
| InChIKey | RSFGTEFRICHALD-DBURXGRCSA-N |
| XLogP | 14.83 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.35 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|