C50H97NO5Si2 — CID 170743263
4-[[6-[[dimethyl(octoxy)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol (PubChem CID 170743263) has the molecular formula C50H97NO5Si2 and a molecular weight of 848.50 g/mol. Its IUPAC name is 4-[[6-[[dimethyl(octoxy)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol.
| Compound Name | 4-[[6-[[dimethyl(octoxy)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 170743263 |
| Molecular Formula | C50H97NO5Si2 |
| Molecular Weight | 848.50 g/mol |
| Exact Mass | 847.69 |
| IUPAC Name | 4-[[6-[[dimethyl(octoxy)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]amino]butan-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCN(CCCCO)CCCCCC(OCCCCCCCC)O[Si](C)(C)O[Si](C)(C)OCCCCCCCC |
| InChI | InChI=1S/C50H97NO5Si2/c1-8-11-14-17-20-21-22-23-24-25-26-27-28-29-30-31-32-37-44-51(46-39-40-47-52)45-38-35-36-43-50(53-48-41-33-18-15-12-9-2)55-58(6,7)56-57(4,5)54-49-42-34-19-16-13-10-3/h11,14,20-21,23-24,26-27,29-30,50,52H,8-10,12-13,15-19,22,25,28,31-49H2,1-7H3/b14-11-,21-20-,24-23-,27-26-,30-29- |
| InChIKey | HMKLBRPOIHVNOB-CBNOXGGWSA-N |
| XLogP | 15.06 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.50 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|