C53H109NO6Si — CID 170743333
heptadecan-9-yl 8-[6-[dimethyl(1-octoxyoctoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]octanoate (PubChem CID 170743333) has the molecular formula C53H109NO6Si and a molecular weight of 884.54 g/mol. Its IUPAC name is heptadecan-9-yl 8-[6-[dimethyl(1-octoxyoctoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[6-[dimethyl(1-octoxyoctoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]octanoate |
|---|---|
| PubChem CID | 170743333 |
| Molecular Formula | C53H109NO6Si |
| Molecular Weight | 884.54 g/mol |
| Exact Mass | 883.80 |
| IUPAC Name | heptadecan-9-yl 8-[6-[dimethyl(1-octoxyoctoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]octanoate |
| SMILES | CCCCCCCCOC(CCCCCCC)O[Si](C)(C)OCCCCCCN(CCCCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C53H109NO6Si/c1-7-11-15-19-24-31-41-51(42-32-25-20-16-12-8-2)59-52(56)43-33-26-22-27-35-45-54(47-37-38-48-55)46-36-28-30-40-50-58-61(5,6)60-53(44-34-23-18-14-10-4)57-49-39-29-21-17-13-9-3/h51,53,55H,7-50H2,1-6H3 |
| InChIKey | NXTVVVLQYFCXBV-UHFFFAOYSA-N |
| XLogP | 16.17 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.54 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|