C53H111NO6Si2 — CID 170743002
heptadecan-9-yl 8-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 170743002) has the molecular formula C53H111NO6Si2 and a molecular weight of 914.64 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 170743002 |
| Molecular Formula | C53H111NO6Si2 |
| Molecular Weight | 914.64 g/mol |
| Exact Mass | 913.79 |
| IUPAC Name | heptadecan-9-yl 8-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCOC(CCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)O[Si](C)(C)O[Si](C)(C)CCCCCCCC |
| InChI | InChI=1S/C53H111NO6Si2/c1-9-13-17-21-26-33-41-51(42-34-27-22-18-14-10-2)58-52(56)43-35-28-25-29-37-45-54(47-48-55)46-38-32-36-44-53(57-49-39-30-23-19-15-11-3)59-62(7,8)60-61(5,6)50-40-31-24-20-16-12-4/h51,53,55H,9-50H2,1-8H3 |
| InChIKey | KJYFAQIZTLGOQM-UHFFFAOYSA-N |
| XLogP | 16.60 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.64 |
| LogP ≤ 5 | 16.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|