C51H108NO7Si2 — CID 170743384
CID 170743384 (PubChem CID 170743384) has the molecular formula C51H108NO7Si2 and a molecular weight of 903.60 g/mol.
| Compound Name | CID 170743384 |
|---|---|
| PubChem CID | 170743384 |
| Molecular Formula | C51H108NO7Si2 |
| Molecular Weight | 903.60 g/mol |
| Exact Mass | 902.77 |
| IUPAC Name | — |
| SMILES | CCCCCCCCOC(CCCCCN(CCCCO)CCCCCC(OCCCCCCCC)O[Si](C)(C)OCCCCCCCC)O[Si](C)OCCCCCCCC |
| InChI | InChI=1S/C51H108NO7Si2/c1-8-12-16-20-24-36-46-54-50(58-60(5)56-48-38-26-22-18-14-10-3)40-30-28-32-42-52(44-34-35-45-53)43-33-29-31-41-51(55-47-37-25-21-17-13-9-2)59-61(6,7)57-49-39-27-23-19-15-11-4/h50-51,53H,8-49H2,1-7H3 |
| InChIKey | RGTRASYOLBPKBW-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.60 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|