C102H214N2O12S2Si4 — CID 175993053
6-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-pentylsulfanyldecanoate (PubChem CID 175993053) has the molecular formula C102H214N2O12S2Si4 and a molecular weight of 1837.31 g/mol. Its IUPAC name is 6-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-pentylsulfanyldecanoate.
| Compound Name | 6-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-pentylsulfanyldecanoate |
|---|---|
| PubChem CID | 175993053 |
| Molecular Formula | C102H214N2O12S2Si4 |
| Molecular Weight | 1837.31 g/mol |
| Exact Mass | 1835.47 |
| IUPAC Name | 6-[[6-[[dimethyl(octyl)silyl]oxy-dimethylsilyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-pentylsulfanyldecanoate |
| SMILES | CCCCCCCCOC(CCCCCN(CCCCO)CCCCCCOC(=O)C(CCCCCCCC)SCCCCC)O[Si](C)(C)O[Si](C)(C)CCCCCCCC.CCCCCCCCOC(CCCCCN(CCCCO)CCCCCCOC(=O)C(CCCCCCCC)SCCCCC)O[Si](C)(C)O[Si](C)(C)CCCCCCCC |
| InChI | InChI=1S/2C51H107NO6SSi2/c2*1-9-13-17-20-23-29-39-49(59-47-37-16-12-4)51(54)56-46-36-26-24-31-41-52(43-33-34-44-53)42-32-28-30-40-50(55-45-35-25-21-18-14-10-2)57-61(7,8)58-60(5,6)48-38-27-22-19-15-11-3/h2*49-50,53H,9-48H2,1-8H3 |
| InChIKey | KHJAJMHPBFVEOU-UHFFFAOYSA-N |
| XLogP | 31.54 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 98 |
| Heavy Atoms | 122 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1837.31 |
| LogP ≤ 5 | 31.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|