C38H75NO5S2 — CID 177036212
6-[6-(2-decylsulfanylhexanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-sulfanylhexanoate (PubChem CID 177036212) has the molecular formula C38H75NO5S2 and a molecular weight of 690.15 g/mol. Its IUPAC name is 6-[6-(2-decylsulfanylhexanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-sulfanylhexanoate.
| Compound Name | 6-[6-(2-decylsulfanylhexanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-sulfanylhexanoate |
|---|---|
| PubChem CID | 177036212 |
| Molecular Formula | C38H75NO5S2 |
| Molecular Weight | 690.15 g/mol |
| Exact Mass | 689.51 |
| IUPAC Name | 6-[6-(2-decylsulfanylhexanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-sulfanylhexanoate |
| SMILES | CCCCCCCCCCSC(CCCC)C(=O)OCCCCCCN(CCCCO)CCCCCCOC(=O)C(S)CCCC |
| InChI | InChI=1S/C38H75NO5S2/c1-4-7-10-11-12-13-18-25-34-46-36(27-9-6-3)38(42)44-33-24-17-15-20-29-39(30-21-22-31-40)28-19-14-16-23-32-43-37(41)35(45)26-8-5-2/h35-36,40,45H,4-34H2,1-3H3 |
| InChIKey | DHVBPJFVEHGJRL-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.15 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|