C48H99NO5S2 — CID 170742967
6-[4-hydroxybutyl-[6-(2-methylpentoxy)-6-octoxyhexyl]amino]hexyl 2-decylsulfanylhexanoate;methylsulfanylmethane (PubChem CID 170742967) has the molecular formula C48H99NO5S2 and a molecular weight of 834.46 g/mol. Its IUPAC name is 6-[4-hydroxybutyl-[6-(2-methylpentoxy)-6-octoxyhexyl]amino]hexyl 2-decylsulfanylhexanoate;methylsulfanylmethane.
| Compound Name | 6-[4-hydroxybutyl-[6-(2-methylpentoxy)-6-octoxyhexyl]amino]hexyl 2-decylsulfanylhexanoate;methylsulfanylmethane |
|---|---|
| PubChem CID | 170742967 |
| Molecular Formula | C48H99NO5S2 |
| Molecular Weight | 834.46 g/mol |
| Exact Mass | 833.70 |
| IUPAC Name | 6-[4-hydroxybutyl-[6-(2-methylpentoxy)-6-octoxyhexyl]amino]hexyl 2-decylsulfanylhexanoate;methylsulfanylmethane |
| SMILES | CCCCCCCCCCSC(CCCC)C(=O)OCCCCCCN(CCCCO)CCCCCC(OCCCCCCCC)OCC(C)CCC.CSC |
| InChI | InChI=1S/C46H93NO5S.C2H6S/c1-6-10-13-15-17-18-22-31-41-53-44(33-12-8-3)46(49)51-40-30-21-19-25-35-47(37-27-28-38-48)36-26-23-24-34-45(52-42-43(5)32-9-4)50-39-29-20-16-14-11-7-2;1-3-2/h43-45,48H,6-42H2,1-5H3;1-2H3 |
| InChIKey | HBEHIFJBRMPUMG-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.46 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|