C16H30O — CID 15717608
(8E)-9,13-dimethyltetradeca-8,12-dien-6-ol (PubChem CID 15717608) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (8E)-9,13-dimethyltetradeca-8,12-dien-6-ol.
| Compound Name | (8E)-9,13-dimethyltetradeca-8,12-dien-6-ol |
|---|---|
| PubChem CID | 15717608 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (8E)-9,13-dimethyltetradeca-8,12-dien-6-ol |
| SMILES | CCCCCC(O)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H30O/c1-5-6-7-11-16(17)13-12-15(4)10-8-9-14(2)3/h9,12,16-17H,5-8,10-11,13H2,1-4H3/b15-12+ |
| InChIKey | VJHAWRBOBAXUQD-NTCAYCPXSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|