C20H40O2Si — CID 91697248
[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-octoxysilane (PubChem CID 91697248) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-octoxysilane.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-octoxysilane |
|---|---|
| PubChem CID | 91697248 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-octoxysilane |
| SMILES | CCCCCCCCO[Si](C)(C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-7-8-9-10-11-12-17-21-23(5,6)22-18-16-20(4)15-13-14-19(2)3/h14,16H,7-13,15,17-18H2,1-6H3/b20-16+ |
| InChIKey | VCTJVVUNWHVNTG-CAPFRKAQSA-N |
| XLogP | 6.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|