C15H26O2 — CID 71553169
[(2R)-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] acetate (PubChem CID 71553169) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is [(2R)-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] acetate.
| Compound Name | [(2R)-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 71553169 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | [(2R)-4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C15H26O2/c1-11-7-6-10-15(4,5)14(11)9-8-12(2)17-13(3)16/h12H,6-10H2,1-5H3/t12-/m1/s1 |
| InChIKey | PSEPWYXAIAKJJV-GFCCVEGCSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|