C40H78Br2N2 — CID 24833325
6-[diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azaniumyl]hexyl-diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azanium dibromide (PubChem CID 24833325) has the molecular formula C40H78Br2N2 and a molecular weight of 746.89 g/mol. Its IUPAC name is 6-[diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azaniumyl]hexyl-diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azanium dibromide.
| Compound Name | 6-[diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azaniumyl]hexyl-diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azanium dibromide |
|---|---|
| PubChem CID | 24833325 |
| Molecular Formula | C40H78Br2N2 |
| Molecular Weight | 746.89 g/mol |
| Exact Mass | 744.45 |
| IUPAC Name | 6-[diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azaniumyl]hexyl-diethyl-[4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-yl]azanium dibromide |
| SMILES | CC[N+](CC)(CCCCCC[N+](CC)(CC)C(C)CCC1=C(C)CCCC1(C)C)C(C)CCC1=C(C)CCCC1(C)C.[Br-].[Br-] |
| InChI | InChI=1S/C40H78N2.2BrH/c1-13-41(14-2,35(7)25-27-37-33(5)23-21-29-39(37,9)10)31-19-17-18-20-32-42(15-3,16-4)36(8)26-28-38-34(6)24-22-30-40(38,11)12;;/h35-36H,13-32H2,1-12H3;2*1H/q+2;;/p-2 |
| InChIKey | GWLMBDKTYHSDJW-UHFFFAOYSA-L |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.89 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|