C15H25NO4 — CID 101238631
(4S)-4-amino-5-oxo-5-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]pentanoic acid (PubChem CID 101238631) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is (4S)-4-amino-5-oxo-5-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]pentanoic acid.
| Compound Name | (4S)-4-amino-5-oxo-5-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]pentanoic acid |
|---|---|
| PubChem CID | 101238631 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (4S)-4-amino-5-oxo-5-[(2,6,6-trimethylcyclohexen-1-yl)methoxy]pentanoic acid |
| SMILES | CC1=C(COC(=O)[C@@H](N)CCC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H25NO4/c1-10-5-4-8-15(2,3)11(10)9-20-14(19)12(16)6-7-13(17)18/h12H,4-9,16H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | LEJUYHPXWFVGOF-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|