C14H25NO4 — CID 67883901
(4S)-4-amino-5-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoic acid (PubChem CID 67883901) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is (4S)-4-amino-5-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoic acid.
| Compound Name | (4S)-4-amino-5-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoic acid |
|---|---|
| PubChem CID | 67883901 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (4S)-4-amino-5-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoic acid |
| SMILES | CC1CC(OC(=O)[C@@H](N)CCC(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO4/c1-9-6-10(8-14(2,3)7-9)19-13(18)11(15)4-5-12(16)17/h9-11H,4-8,15H2,1-3H3,(H,16,17)/t9?,10?,11-/m0/s1 |
| InChIKey | AOBNAJDTVBAHSV-ILDUYXDCSA-N |
| XLogP | 1.94 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |