C15H29NO2 — CID 113353136
(3,3,5-trimethylcyclohexyl) (2R)-2-amino-3,3-dimethylbutanoate (PubChem CID 113353136) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) (2R)-2-amino-3,3-dimethylbutanoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) (2R)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 113353136 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) (2R)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC1CC(OC(=O)[C@H](N)C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H29NO2/c1-10-7-11(9-15(5,6)8-10)18-13(17)12(16)14(2,3)4/h10-12H,7-9,16H2,1-6H3/t10?,11?,12-/m0/s1 |
| InChIKey | CEQGCQNDDRYASJ-MCIGGMRASA-N |
| XLogP | 3.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |