C18H25ClO3 — CID 3045118
(3,3,5-trimethylcyclohexyl) 2-(4-chlorophenoxy)propanoate (PubChem CID 3045118) has the molecular formula C18H25ClO3 and a molecular weight of 324.85 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 2-(4-chlorophenoxy)propanoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 3045118 |
| Molecular Formula | C18H25ClO3 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 2-(4-chlorophenoxy)propanoate |
| SMILES | CC1CC(OC(=O)C(C)Oc2ccc(Cl)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H25ClO3/c1-12-9-16(11-18(3,4)10-12)22-17(20)13(2)21-15-7-5-14(19)6-8-15/h5-8,12-13,16H,9-11H2,1-4H3 |
| InChIKey | ZRQIJNNWPFPQCF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |