C16H24ClO5P2+ — CID 123598165
1-(5,5-dimethyl-2-phosphanyl-1,3,2-dioxaphosphinan-2-ium-2-yl)ethyl 2-(4-chlorophenoxy)propanoate (PubChem CID 123598165) has the molecular formula C16H24ClO5P2+ and a molecular weight of 393.76 g/mol. Its IUPAC name is 1-(5,5-dimethyl-2-phosphanyl-1,3,2-dioxaphosphinan-2-ium-2-yl)ethyl 2-(4-chlorophenoxy)propanoate.
| Compound Name | 1-(5,5-dimethyl-2-phosphanyl-1,3,2-dioxaphosphinan-2-ium-2-yl)ethyl 2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 123598165 |
| Molecular Formula | C16H24ClO5P2+ |
| Molecular Weight | 393.76 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 1-(5,5-dimethyl-2-phosphanyl-1,3,2-dioxaphosphinan-2-ium-2-yl)ethyl 2-(4-chlorophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)OC(C)[P+]1(P)OCC(C)(C)CO1 |
| InChI | InChI=1S/C16H24ClO5P2/c1-11(21-14-7-5-13(17)6-8-14)15(18)22-12(2)24(23)19-9-16(3,4)10-20-24/h5-8,11-12H,9-10,23H2,1-4H3/q+1 |
| InChIKey | KGJSQNVRZSWYKK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|