C13H18ClO6P — CID 141174625
1-[2-(4-chlorophenoxy)propanoyloxy]butylphosphonic acid (PubChem CID 141174625) has the molecular formula C13H18ClO6P and a molecular weight of 336.71 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)propanoyloxy]butylphosphonic acid.
| Compound Name | 1-[2-(4-chlorophenoxy)propanoyloxy]butylphosphonic acid |
|---|---|
| PubChem CID | 141174625 |
| Molecular Formula | C13H18ClO6P |
| Molecular Weight | 336.71 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)propanoyloxy]butylphosphonic acid |
| SMILES | CCCC(OC(=O)C(C)Oc1ccc(Cl)cc1)P(=O)(O)O |
| InChI | InChI=1S/C13H18ClO6P/c1-3-4-12(21(16,17)18)20-13(15)9(2)19-11-7-5-10(14)6-8-11/h5-9,12H,3-4H2,1-2H3,(H2,16,17,18) |
| InChIKey | UGNZPKIVQXZXMY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|