C9H12ClO4P — CID 67896199
1-(4-chlorophenoxy)propylphosphonic acid (PubChem CID 67896199) has the molecular formula C9H12ClO4P and a molecular weight of 250.62 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)propylphosphonic acid.
| Compound Name | 1-(4-chlorophenoxy)propylphosphonic acid |
|---|---|
| PubChem CID | 67896199 |
| Molecular Formula | C9H12ClO4P |
| Molecular Weight | 250.62 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-(4-chlorophenoxy)propylphosphonic acid |
| SMILES | CCC(Oc1ccc(Cl)cc1)P(=O)(O)O |
| InChI | InChI=1S/C9H12ClO4P/c1-2-9(15(11,12)13)14-8-5-3-7(10)4-6-8/h3-6,9H,2H2,1H3,(H2,11,12,13) |
| InChIKey | LEAZQBLVJZKFRF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|