C12H15ClLiO6P — CID 141174638
lithium 1-[2-(4-chlorophenoxy)propanoyloxy]propyl-hydroxyphosphinate (PubChem CID 141174638) has the molecular formula C12H15ClLiO6P and a molecular weight of 328.61 g/mol. Its IUPAC name is lithium 1-[2-(4-chlorophenoxy)propanoyloxy]propyl-hydroxyphosphinate.
| Compound Name | lithium 1-[2-(4-chlorophenoxy)propanoyloxy]propyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 141174638 |
| Molecular Formula | C12H15ClLiO6P |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | lithium 1-[2-(4-chlorophenoxy)propanoyloxy]propyl-hydroxyphosphinate |
| SMILES | CCC(OC(=O)C(C)Oc1ccc(Cl)cc1)P(=O)([O-])O.[Li+] |
| InChI | InChI=1S/C12H16ClO6P.Li/c1-3-11(20(15,16)17)19-12(14)8(2)18-10-6-4-9(13)5-7-10;/h4-8,11H,3H2,1-2H3,(H2,15,16,17);/q;+1/p-1 |
| InChIKey | JOJYPRDQMAVTCY-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|