C13H16Cl2NaO6P — CID 141174653
sodium 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxypentyl-hydroxyphosphinate (PubChem CID 141174653) has the molecular formula C13H16Cl2NaO6P and a molecular weight of 393.14 g/mol. Its IUPAC name is sodium 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxypentyl-hydroxyphosphinate.
| Compound Name | sodium 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxypentyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 141174653 |
| Molecular Formula | C13H16Cl2NaO6P |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | sodium 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxypentyl-hydroxyphosphinate |
| SMILES | CCCCC(OC(=O)C(Cl)Oc1ccc(Cl)cc1)P(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C13H17Cl2O6P.Na/c1-2-3-4-11(22(17,18)19)21-13(16)12(15)20-10-7-5-9(14)6-8-10;/h5-8,11-12H,2-4H2,1H3,(H2,17,18,19);/q;+1/p-1 |
| InChIKey | HTMDYGLUCYGJIM-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|