About bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate
bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate (PubChem CID 141174640) has the molecular formula C21H40ClN2O6P
and a molecular weight of 482.99 g/mol. Its IUPAC name is bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate.
Molecular Properties
| Compound Name | bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate |
| PubChem CID | 141174640 |
| Molecular Formula | C21H40ClN2O6P |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate |
| SMILES | CC(C)(C)[NH3+].CC(C)(C)[NH3+].CCCCC(OC(=O)C(Cl)Oc1ccccc1)P(=O)([O-])[O-] |
| InChI | InChI=1S/C13H18ClO6P.2C4H11N/c1-2-3-9-11(21(16,17)18)20-13(15)12(14)19-10-7-5-4-6-8-10;2*1-4(2,3)5/h4-8,11-12H,2-3,9H2,1H3,(H2,16,17,18);2*5H2,1-3H3 |
| InChIKey | VGPADHBBFPTSBL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate?
The IUPAC name of bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate (CID 141174640) is bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate.
What is the SMILES notation for bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate?
The canonical SMILES for bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate is CC(C)(C)[NH3+].CC(C)(C)[NH3+].CCCCC(OC(=O)C(Cl)Oc1ccccc1)P(=O)([O-])[O-].
What is the InChIKey of bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate?
The InChIKey is VGPADHBBFPTSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClO6P.2C4H11N/c1-2-3-9-11(21(16,17)18)20-13(15)12(14)19-10-7-5-4-6-8-10;2*1-4(2,3)5/h4-8,11-12H,2-3,9H2,1H3,(H2,16,17,18);2*5H2,1-3H3.
What are the key properties of bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate?
bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate has a molecular weight of 482.99 g/mol, XLogP of 1.66, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butylazanium);1-phosphonatopentyl 2-chloro-2-phenoxyacetate is sourced from PubChem (CID 141174640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).