About 1-phenoxypentan-1-amine
1-phenoxypentan-1-amine (PubChem CID 68557687) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-phenoxypentan-1-amine.
Molecular Properties
| Compound Name | 1-phenoxypentan-1-amine |
| PubChem CID | 68557687 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-phenoxypentan-1-amine |
| SMILES | CCCCC(N)Oc1ccccc1 |
| InChI | InChI=1S/C11H17NO/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h4-8,11H,2-3,9,12H2,1H3 |
| InChIKey | XYOLFZARONRTOA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxypentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxypentan-1-amine?
The IUPAC name of 1-phenoxypentan-1-amine (CID 68557687) is 1-phenoxypentan-1-amine.
What is the SMILES notation for 1-phenoxypentan-1-amine?
The canonical SMILES for 1-phenoxypentan-1-amine is CCCCC(N)Oc1ccccc1.
What is the InChIKey of 1-phenoxypentan-1-amine?
The InChIKey is XYOLFZARONRTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h4-8,11H,2-3,9,12H2,1H3.
What are the key properties of 1-phenoxypentan-1-amine?
1-phenoxypentan-1-amine has a molecular weight of 179.26 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxypentan-1-amine is sourced from PubChem (CID 68557687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).