C16H20O — CID 11986274
1-cyclopenta-2,4-dien-1-ylpentoxybenzene (PubChem CID 11986274) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylpentoxybenzene.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylpentoxybenzene |
|---|---|
| PubChem CID | 11986274 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylpentoxybenzene |
| SMILES | CCCCC(Oc1ccccc1)C1C=CC=C1 |
| InChI | InChI=1S/C16H20O/c1-2-3-13-16(14-9-7-8-10-14)17-15-11-5-4-6-12-15/h4-12,14,16H,2-3,13H2,1H3 |
| InChIKey | DKCMIULKIXUEBK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |