C12H15Cl2O6P — CID 141174613
1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxybutylphosphonic acid (PubChem CID 141174613) has the molecular formula C12H15Cl2O6P and a molecular weight of 357.13 g/mol. Its IUPAC name is 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxybutylphosphonic acid.
| Compound Name | 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxybutylphosphonic acid |
|---|---|
| PubChem CID | 141174613 |
| Molecular Formula | C12H15Cl2O6P |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 1-[2-chloro-2-(4-chlorophenoxy)acetyl]oxybutylphosphonic acid |
| SMILES | CCCC(OC(=O)C(Cl)Oc1ccc(Cl)cc1)P(=O)(O)O |
| InChI | InChI=1S/C12H15Cl2O6P/c1-2-3-10(21(16,17)18)20-12(15)11(14)19-9-6-4-8(13)5-7-9/h4-7,10-11H,2-3H2,1H3,(H2,16,17,18) |
| InChIKey | FHNIITIDHPWFLP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|