C16H15ClKO6P — CID 141174626
potassium [2-(4-chlorophenoxy)propanoyloxy-phenylmethyl]-hydroxyphosphinate (PubChem CID 141174626) has the molecular formula C16H15ClKO6P and a molecular weight of 408.82 g/mol. Its IUPAC name is potassium [2-(4-chlorophenoxy)propanoyloxy-phenylmethyl]-hydroxyphosphinate.
| Compound Name | potassium [2-(4-chlorophenoxy)propanoyloxy-phenylmethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 141174626 |
| Molecular Formula | C16H15ClKO6P |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | potassium [2-(4-chlorophenoxy)propanoyloxy-phenylmethyl]-hydroxyphosphinate |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)OC(c1ccccc1)P(=O)([O-])O.[K+] |
| InChI | InChI=1S/C16H16ClO6P.K/c1-11(22-14-9-7-13(17)8-10-14)15(18)23-16(24(19,20)21)12-5-3-2-4-6-12;/h2-11,16H,1H3,(H2,19,20,21);/q;+1/p-1 |
| InChIKey | VXXGNQVCQIQTRA-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|