About [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate
[phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 18697533) has the molecular formula C24H23ClO3
and a molecular weight of 394.90 g/mol. Its IUPAC name is [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
| PubChem CID | 18697533 |
| Molecular Formula | C24H23ClO3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OC(Oc1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClO3/c1-17(2)22(18-13-15-20(25)16-14-18)23(26)28-24(19-9-5-3-6-10-19)27-21-11-7-4-8-12-21/h3-17,22,24H,1-2H3 |
| InChIKey | WUBUXTPKCKFJQH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate?
The IUPAC name of [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate (CID 18697533) is [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate.
What is the SMILES notation for [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate?
The canonical SMILES for [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate is CC(C)C(C(=O)OC(Oc1ccccc1)c1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate?
The InChIKey is WUBUXTPKCKFJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23ClO3/c1-17(2)22(18-13-15-20(25)16-14-18)23(26)28-24(19-9-5-3-6-10-19)27-21-11-7-4-8-12-21/h3-17,22,24H,1-2H3.
What are the key properties of [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate?
[phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate has a molecular weight of 394.90 g/mol, XLogP of 6.40, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [phenoxy(phenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate is sourced from PubChem (CID 18697533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).