C25H26ClNO4 — CID 169451341
[(1S)-2-aminooxy-1-(3-phenoxyphenyl)ethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 169451341) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is [(1S)-2-aminooxy-1-(3-phenoxyphenyl)ethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [(1S)-2-aminooxy-1-(3-phenoxyphenyl)ethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 169451341 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [(1S)-2-aminooxy-1-(3-phenoxyphenyl)ethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)O[C@H](CON)c1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H26ClNO4/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)31-23(16-29-27)19-7-6-10-22(15-19)30-21-8-4-3-5-9-21/h3-15,17,23-24H,16,27H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | YGCODIRSOKODNQ-RPWUZVMVSA-N |
| XLogP | 6.05 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|