C21H18Cl3NO3 — CID 54275261
[cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 54275261) has the molecular formula C21H18Cl3NO3 and a molecular weight of 438.74 g/mol. Its IUPAC name is [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 54275261 |
| Molecular Formula | C21H18Cl3NO3 |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)OC(C#N)c1cccc(OC=C(Cl)Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl3NO3/c1-13(2)20(14-6-8-16(22)9-7-14)21(26)28-18(11-25)15-4-3-5-17(10-15)27-12-19(23)24/h3-10,12-13,18,20H,1-2H3/t18?,20-/m0/s1 |
| InChIKey | RMYQVXLHMBTQAS-IJHRGXPZSA-N |
| XLogP | 6.54 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|