C24H21Cl2NO3 — CID 20568944
[cyano-(3-phenoxyphenyl)methyl] 5,5-dichloro-2-(cyclobuten-1-yl)-3-methylpent-4-enoate (PubChem CID 20568944) has the molecular formula C24H21Cl2NO3 and a molecular weight of 442.34 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 5,5-dichloro-2-(cyclobuten-1-yl)-3-methylpent-4-enoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 5,5-dichloro-2-(cyclobuten-1-yl)-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 20568944 |
| Molecular Formula | C24H21Cl2NO3 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 5,5-dichloro-2-(cyclobuten-1-yl)-3-methylpent-4-enoate |
| SMILES | CC(C=C(Cl)Cl)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)C1=CCC1 |
| InChI | InChI=1S/C24H21Cl2NO3/c1-16(13-22(25)26)23(17-7-5-8-17)24(28)30-21(15-27)18-9-6-12-20(14-18)29-19-10-3-2-4-11-19/h2-4,6-7,9-14,16,21,23H,5,8H2,1H3 |
| InChIKey | LMCLCLZWAOFRFC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|