C23H27NO4 — CID 12874290
[cyano-(3-phenoxyphenyl)methyl] 3-methyl-2-(propan-2-yloxymethyl)butanoate (PubChem CID 12874290) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 3-methyl-2-(propan-2-yloxymethyl)butanoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 3-methyl-2-(propan-2-yloxymethyl)butanoate |
|---|---|
| PubChem CID | 12874290 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 3-methyl-2-(propan-2-yloxymethyl)butanoate |
| SMILES | CC(C)OCC(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C23H27NO4/c1-16(2)21(15-26-17(3)4)23(25)28-22(14-24)18-9-8-12-20(13-18)27-19-10-6-5-7-11-19/h5-13,16-17,21-22H,15H2,1-4H3 |
| InChIKey | MJSSPIGBXBKVPD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |