C26H25NO5 — CID 10693987
[cyano-(3-phenoxyphenyl)methyl] 2-(2-methoxyphenoxy)-3-methylbutanoate (PubChem CID 10693987) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2-(2-methoxyphenoxy)-3-methylbutanoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2-(2-methoxyphenoxy)-3-methylbutanoate |
|---|---|
| PubChem CID | 10693987 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2-(2-methoxyphenoxy)-3-methylbutanoate |
| SMILES | COc1ccccc1OC(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C26H25NO5/c1-18(2)25(31-23-15-8-7-14-22(23)29-3)26(28)32-24(17-27)19-10-9-13-21(16-19)30-20-11-5-4-6-12-20/h4-16,18,24-25H,1-3H3 |
| InChIKey | ZUKNVJDRFWWFQX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |