C18H17NO3 — CID 11266404
[(R)-cyano-(3-phenoxyphenyl)methyl] butanoate (PubChem CID 11266404) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [(R)-cyano-(3-phenoxyphenyl)methyl] butanoate.
| Compound Name | [(R)-cyano-(3-phenoxyphenyl)methyl] butanoate |
|---|---|
| PubChem CID | 11266404 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [(R)-cyano-(3-phenoxyphenyl)methyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H17NO3/c1-2-7-18(20)22-17(13-19)14-8-6-11-16(12-14)21-15-9-4-3-5-10-15/h3-6,8-12,17H,2,7H2,1H3/t17-/m0/s1 |
| InChIKey | JZTLZAUEQAEOAC-KRWDZBQOSA-N |
| XLogP | 4.39 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |