C25H31NO3 — CID 71386880
[cyano-(3-phenoxyphenyl)methyl] 2-propan-2-yloctanoate (PubChem CID 71386880) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2-propan-2-yloctanoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2-propan-2-yloctanoate |
|---|---|
| PubChem CID | 71386880 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2-propan-2-yloctanoate |
| SMILES | CCCCCCC(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C25H31NO3/c1-4-5-6-10-16-23(19(2)3)25(27)29-24(18-26)20-12-11-15-22(17-20)28-21-13-8-7-9-14-21/h7-9,11-15,17,19,23-24H,4-6,10,16H2,1-3H3 |
| InChIKey | YPDCWTMGNVTCEH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|