C22H25NO3 — CID 71386879
[cyano-(3-phenoxyphenyl)methyl] 2-propan-2-ylpentanoate (PubChem CID 71386879) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2-propan-2-ylpentanoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 71386879 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2-propan-2-ylpentanoate |
| SMILES | CCCC(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C22H25NO3/c1-4-9-20(16(2)3)22(24)26-21(15-23)17-10-8-13-19(14-17)25-18-11-6-5-7-12-18/h5-8,10-14,16,20-21H,4,9H2,1-3H3 |
| InChIKey | YISBFTHGQGGOIQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |