C27H21NO3 — CID 70636929
[cyano-(3-phenoxyphenyl)methyl] 2-naphthalen-1-ylpropanoate (PubChem CID 70636929) has the molecular formula C27H21NO3 and a molecular weight of 407.47 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2-naphthalen-1-ylpropanoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 70636929 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2-naphthalen-1-ylpropanoate |
| SMILES | CC(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H21NO3/c1-19(24-16-8-10-20-9-5-6-15-25(20)24)27(29)31-26(18-28)21-11-7-14-23(17-21)30-22-12-3-2-4-13-22/h2-17,19,26H,1H3 |
| InChIKey | QIELHATVAPDPSD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |