C26H22ClF3N2O3 — CID 88634803
[cyano-(3-phenoxyphenyl)methyl] 2-chloro-3-methyl-4-[N-(trifluoromethyl)anilino]butanoate (PubChem CID 88634803) has the molecular formula C26H22ClF3N2O3 and a molecular weight of 502.92 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] 2-chloro-3-methyl-4-[N-(trifluoromethyl)anilino]butanoate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] 2-chloro-3-methyl-4-[N-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 88634803 |
| Molecular Formula | C26H22ClF3N2O3 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] 2-chloro-3-methyl-4-[N-(trifluoromethyl)anilino]butanoate |
| SMILES | CC(CN(c1ccccc1)C(F)(F)F)C(Cl)C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H22ClF3N2O3/c1-18(17-32(26(28,29)30)20-10-4-2-5-11-20)24(27)25(33)35-23(16-31)19-9-8-14-22(15-19)34-21-12-6-3-7-13-21/h2-15,18,23-24H,17H2,1H3 |
| InChIKey | QGIQDSIJCFYYKV-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|