C25H23ClN2O2 — CID 13106591
[(3-anilinophenyl)-cyanomethyl] 2-(3-chlorophenyl)-3-methylbutanoate (PubChem CID 13106591) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is [(3-anilinophenyl)-cyanomethyl] 2-(3-chlorophenyl)-3-methylbutanoate.
| Compound Name | [(3-anilinophenyl)-cyanomethyl] 2-(3-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 13106591 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [(3-anilinophenyl)-cyanomethyl] 2-(3-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(Nc2ccccc2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-17(2)24(19-9-6-10-20(26)14-19)25(29)30-23(16-27)18-8-7-13-22(15-18)28-21-11-4-3-5-12-21/h3-15,17,23-24,28H,1-2H3 |
| InChIKey | RUDMIJVYMAVJGP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |