C25H30N2O3 — CID 13080317
[(3-anilinophenyl)-cyanomethyl] 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate (PubChem CID 13080317) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is [(3-anilinophenyl)-cyanomethyl] 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate.
| Compound Name | [(3-anilinophenyl)-cyanomethyl] 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13080317 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [(3-anilinophenyl)-cyanomethyl] 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate |
| SMILES | CCCCCOC1C(C(=O)OC(C#N)c2cccc(Nc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C25H30N2O3/c1-4-5-9-15-29-23-22(25(23,2)3)24(28)30-21(17-26)18-11-10-14-20(16-18)27-19-12-7-6-8-13-19/h6-8,10-14,16,21-23,27H,4-5,9,15H2,1-3H3 |
| InChIKey | QBZQXJUNMXEESK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|