C20H18Cl2N2O2 — CID 13080308
[(3-anilinophenyl)-cyanomethyl] 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate (PubChem CID 13080308) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is [(3-anilinophenyl)-cyanomethyl] 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate.
| Compound Name | [(3-anilinophenyl)-cyanomethyl] 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13080308 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [(3-anilinophenyl)-cyanomethyl] 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)OC(C#N)c2cccc(Nc3ccccc3)c2)C1(Cl)Cl |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-19(2)17(20(19,21)22)18(25)26-16(12-23)13-7-6-10-15(11-13)24-14-8-4-3-5-9-14/h3-11,16-17,24H,1-2H3 |
| InChIKey | WSRPXPWXTXHBNP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|