C25H24ClNO3 — CID 90394362
[cyano-[3-[(1E,3Z)-hexa-1,3,5-trienoxy]phenyl]methyl] 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 90394362) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is [cyano-[3-[(1E,3Z)-hexa-1,3,5-trienoxy]phenyl]methyl] 2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [cyano-[3-[(1E,3Z)-hexa-1,3,5-trienoxy]phenyl]methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 90394362 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [cyano-[3-[(1E,3Z)-hexa-1,3,5-trienoxy]phenyl]methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | C=C/C=C\C=C\Oc1cccc(C(C#N)OC(=O)C(c2ccc(Cl)cc2)C(C)C)c1 |
| InChI | InChI=1S/C25H24ClNO3/c1-4-5-6-7-15-29-22-10-8-9-20(16-22)23(17-27)30-25(28)24(18(2)3)19-11-13-21(26)14-12-19/h4-16,18,23-24H,1H2,2-3H3/b6-5-,15-7+ |
| InChIKey | BKRSDTGXBCCYDD-LPWWCAIVSA-N |
| XLogP | 6.52 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|