About [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate
[cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate (PubChem CID 54058320) has the molecular formula C19H20Cl3NO3
and a molecular weight of 416.73 g/mol. Its IUPAC name is [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate.
Molecular Properties
| Compound Name | [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate |
| PubChem CID | 54058320 |
| Molecular Formula | C19H20Cl3NO3 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate |
| SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(OC=C(Cl)Cl)c1)C(C)C=CCl |
| InChI | InChI=1S/C19H20Cl3NO3/c1-12(2)18(13(3)7-8-20)19(24)26-16(10-23)14-5-4-6-15(9-14)25-11-17(21)22/h4-9,11-13,16,18H,1-3H3 |
| InChIKey | LXWBWFDXEZUSRQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate?
The IUPAC name of [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate (CID 54058320) is [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate.
What is the SMILES notation for [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate?
The canonical SMILES for [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate is CC(C)C(C(=O)OC(C#N)c1cccc(OC=C(Cl)Cl)c1)C(C)C=CCl.
What is the InChIKey of [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate?
The InChIKey is LXWBWFDXEZUSRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl3NO3/c1-12(2)18(13(3)7-8-20)19(24)26-16(10-23)14-5-4-6-15(9-14)25-11-17(21)22/h4-9,11-13,16,18H,1-3H3.
What are the key properties of [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate?
[cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate has a molecular weight of 416.73 g/mol, XLogP of 6.11, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano-[3-(2,2-dichloroethenoxy)phenyl]methyl] 5-chloro-3-methyl-2-propan-2-ylpent-4-enoate is sourced from PubChem (CID 54058320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).