C24H30O4 — CID 70558271
[phenoxy(phenyl)methyl] 2-cyclohexyloxy-3-methylbutanoate (PubChem CID 70558271) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is [phenoxy(phenyl)methyl] 2-cyclohexyloxy-3-methylbutanoate.
| Compound Name | [phenoxy(phenyl)methyl] 2-cyclohexyloxy-3-methylbutanoate |
|---|---|
| PubChem CID | 70558271 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [phenoxy(phenyl)methyl] 2-cyclohexyloxy-3-methylbutanoate |
| SMILES | CC(C)C(OC1CCCCC1)C(=O)OC(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30O4/c1-18(2)22(26-20-14-8-4-9-15-20)23(25)28-24(19-12-6-3-7-13-19)27-21-16-10-5-11-17-21/h3,5-7,10-13,16-18,20,22,24H,4,8-9,14-15H2,1-2H3 |
| InChIKey | RKCZHUZGUZXLNP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|